| dbo:abstract
|
- Methylprednisolone succinate, sold under the brand names Solu-Medrol among others, is a synthetic glucocorticoid corticosteroid and a corticosteroid ester—specifically the C21 succinate ester of methylprednisolone—which is used by intravenous administration. Methylprednisolone succinate is provided as two different salts when used as a pharmaceutical drug: a sodium salt (methylprednisolone sodium succinate; brand name Solu-Medrol, others) and a hydrogen salt (methylprednisolone hemisuccinate or methylprednisolone hydrogen succinate; brand name Urbason). (en)
|
| dbo:alternativeName
|
- Solu-Medrol, Solu-Medrone, Urbason, others (en)
|
| dbo:casNumber
|
- 2375-03-3 (sodium)
- 2921-57-5
|
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3564 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:casSupplemental
| |
| dbp:chembl
| |
| dbp:class
| |
| dbp:drugbank
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:kegg
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[C@H]1C[C@H]2[C@@H]3CC[C@@]O (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- IMBXEJJVJRTNOW-XYMSELFBSA-N (en)
|
| dbp:synonyms
|
- Methylprednisolone hemisuccinate; 6α-Methylprednisolone 21-hemisuccinate (en)
|
| dbp:tradename
|
- Solu-Medrol, Solu-Medrone, Urbason, others (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Methylprednisolone succinate, sold under the brand names Solu-Medrol among others, is a synthetic glucocorticoid corticosteroid and a corticosteroid ester—specifically the C21 succinate ester of methylprednisolone—which is used by intravenous administration. Methylprednisolone succinate is provided as two different salts when used as a pharmaceutical drug: a sodium salt (methylprednisolone sodium succinate; brand name Solu-Medrol, others) and a hydrogen salt (methylprednisolone hemisuccinate or methylprednisolone hydrogen succinate; brand name Urbason). (en)
|
| rdfs:label
|
- Methylprednisolone succinate (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
